Explore Interrelationships Among Foods, Diseases, Genes and Chemicals
Explore Interrelationships Among Foods, Diseases, Genes and Chemicals
| PubChem CID | 5281780 |
|---|---|
| SMILES | C1C(C(C(CC1(C(=O)O)O)OC(=O)C=CC2=CC(=C(C=C2)O)O)OC(=O)C=CC3=CC(=C(C=C3)O)O)O |
| Common Name | 3,4-Dicaffeoylquinic Acid |
| IUPAC Name | (1S,3R,4R,5R)-3,4-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-1,5-dihydroxycyclohexane-1-carboxylic acid |
| Functional Group(s) | Hydroxy compound, Alcohol, Sec. alcohol, Tert. alcohol, Phenol, 1,2-diphenol, Carboxylic acid deriv., Carboxylic acid, Carboxylic acid ester, Alkene, Aromatic compound, Alpha-hydroxyacid |
| Molecular Properties |
