BitterSweet Predict

× Predict bitter/sweet taste, sweetness intensity or bitter receptors activated by a molecule.
You may use the SMILES, PubChem, or ZINC15 identifier for a molecule. Please limit the query to 10 molecules at a time.
× Predict bitter/sweet taste, sweetness intensity or bitter receptors activated by a molecule.
You may use the SMILES, PubChem, or ZINC15 identifier for a molecule. Please limit the query to 10 molecules at a time.

Input format (one molecule per line)

For example:

O=CC=Cc1ccccc1
C1=CC=C2C(=C1)C(=O)[N-]S2(=O)=O.[K+]
C[C@H]1C(=[NH+][C@H](O1)C)C
OCC(C(=O)OC)NC(=O)C(CC(=O)O)N
× Predict bitter/sweet taste, sweetness intensity or bitter receptors activated by a molecule.
You may use the SMILES, PubChem, or ZINC15 identifier for a molecule. Please limit the query to 10 molecules at a time.
function limitTextareaLine(e) { if(e.keyCode == 13 && $(this).val().split("\n").length >= $(this).attr('rows')) { return false; }